About [[6-(trifluoromethyl)-2,3-dihydroinden-1-ylidene]amino] acetate
[[6-(trifluoromethyl)-2,3-dihydroinden-1-ylidene]amino] acetate (PubChem CID 88792747) has the molecular formula C12H10F3NO2
and a molecular weight of 257.21 g/mol. Its IUPAC name is [[6-(trifluoromethyl)-2,3-dihydroinden-1-ylidene]amino] acetate.
Molecular Properties
| Compound Name | [[6-(trifluoromethyl)-2,3-dihydroinden-1-ylidene]amino] acetate |
| PubChem CID | 88792747 |
| Molecular Formula | C12H10F3NO2 |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | [[6-(trifluoromethyl)-2,3-dihydroinden-1-ylidene]amino] acetate |
| SMILES | CC(=O)ON=C1CCc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C12H10F3NO2/c1-7(17)18-16-11-5-3-8-2-4-9(6-10(8)11)12(13,14)15/h2,4,6H,3,5H2,1H3 |
| InChIKey | ZIZPYGGMNJWUGN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[6-(trifluoromethyl)-2,3-dihydroinden-1-ylidene]amino] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[6-(trifluoromethyl)-2,3-dihydroinden-1-ylidene]amino] acetate?
The IUPAC name of [[6-(trifluoromethyl)-2,3-dihydroinden-1-ylidene]amino] acetate (CID 88792747) is [[6-(trifluoromethyl)-2,3-dihydroinden-1-ylidene]amino] acetate.
What is the SMILES notation for [[6-(trifluoromethyl)-2,3-dihydroinden-1-ylidene]amino] acetate?
The canonical SMILES for [[6-(trifluoromethyl)-2,3-dihydroinden-1-ylidene]amino] acetate is CC(=O)ON=C1CCc2ccc(C(F)(F)F)cc21.
What is the InChIKey of [[6-(trifluoromethyl)-2,3-dihydroinden-1-ylidene]amino] acetate?
The InChIKey is ZIZPYGGMNJWUGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F3NO2/c1-7(17)18-16-11-5-3-8-2-4-9(6-10(8)11)12(13,14)15/h2,4,6H,3,5H2,1H3.
What are the key properties of [[6-(trifluoromethyl)-2,3-dihydroinden-1-ylidene]amino] acetate?
[[6-(trifluoromethyl)-2,3-dihydroinden-1-ylidene]amino] acetate has a molecular weight of 257.21 g/mol, XLogP of 2.92, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [[6-(trifluoromethyl)-2,3-dihydroinden-1-ylidene]amino] acetate is sourced from PubChem (CID 88792747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).