C8H12ClN3S — CID 88792900
3,5-dimethyl-2,3-dihydroimidazo[1,2-c]pyrimidine-2-thiol;hydrochloride (PubChem CID 88792900) has the molecular formula C8H12ClN3S and a molecular weight of 217.73 g/mol. Its IUPAC name is 3,5-dimethyl-2,3-dihydroimidazo[1,2-c]pyrimidine-2-thiol;hydrochloride.
| Compound Name | 3,5-dimethyl-2,3-dihydroimidazo[1,2-c]pyrimidine-2-thiol;hydrochloride |
|---|---|
| PubChem CID | 88792900 |
| Molecular Formula | C8H12ClN3S |
| Molecular Weight | 217.73 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 3,5-dimethyl-2,3-dihydroimidazo[1,2-c]pyrimidine-2-thiol;hydrochloride |
| SMILES | CC1=NC=CC2=NC(S)C(C)N12.Cl |
| InChI | InChI=1S/C8H11N3S.ClH/c1-5-8(12)10-7-3-4-9-6(2)11(5)7;/h3-5,8,12H,1-2H3;1H |
| InChIKey | JTNPLHGUNLAPQE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 27.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.73 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|