C10H10N2O8 — CID 88792928
3-nitro-2-(3,3,3-trihydroxypropanoylamino)benzoic acid (PubChem CID 88792928) has the molecular formula C10H10N2O8 and a molecular weight of 286.20 g/mol. Its IUPAC name is 3-nitro-2-(3,3,3-trihydroxypropanoylamino)benzoic acid.
| Compound Name | 3-nitro-2-(3,3,3-trihydroxypropanoylamino)benzoic acid |
|---|---|
| PubChem CID | 88792928 |
| Molecular Formula | C10H10N2O8 |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 3-nitro-2-(3,3,3-trihydroxypropanoylamino)benzoic acid |
| SMILES | O=C(CC(O)(O)O)Nc1c(C(=O)O)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N2O8/c13-7(4-10(16,17)18)11-8-5(9(14)15)2-1-3-6(8)12(19)20/h1-3,16-18H,4H2,(H,11,13)(H,14,15) |
| InChIKey | HOCAZNNTJXCARU-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 170.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|