About carbamothioic S-acid;N,N-diethylethanamine;(6-methyl-2-pyridinyl)carbamothioic S-acid
carbamothioic S-acid;N,N-diethylethanamine;(6-methyl-2-pyridinyl)carbamothioic S-acid (PubChem CID 88793272) has the molecular formula C14H26N4O2S2
and a molecular weight of 346.52 g/mol. Its IUPAC name is carbamothioic S-acid;N,N-diethylethanamine;(6-methyl-2-pyridinyl)carbamothioic S-acid.
Molecular Properties
| Compound Name | carbamothioic S-acid;N,N-diethylethanamine;(6-methyl-2-pyridinyl)carbamothioic S-acid |
| PubChem CID | 88793272 |
| Molecular Formula | C14H26N4O2S2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | carbamothioic S-acid;N,N-diethylethanamine;(6-methyl-2-pyridinyl)carbamothioic S-acid |
| SMILES | CCN(CC)CC.Cc1cccc(NC(=O)S)n1.NC(=O)S |
| InChI | InChI=1S/C7H8N2OS.C6H15N.CH3NOS/c1-5-3-2-4-6(8-5)9-7(10)11;1-4-7(5-2)6-3;2-1(3)4/h2-4H,1H3,(H2,8,9,10,11);4-6H2,1-3H3;(H3,2,3,4) |
| InChIKey | FDVCHEGOKYBNQO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze carbamothioic S-acid;N,N-diethylethanamine;(6-methyl-2-pyridinyl)carbamothioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamothioic S-acid;N,N-diethylethanamine;(6-methyl-2-pyridinyl)carbamothioic S-acid?
The IUPAC name of carbamothioic S-acid;N,N-diethylethanamine;(6-methyl-2-pyridinyl)carbamothioic S-acid (CID 88793272) is carbamothioic S-acid;N,N-diethylethanamine;(6-methyl-2-pyridinyl)carbamothioic S-acid.
What is the SMILES notation for carbamothioic S-acid;N,N-diethylethanamine;(6-methyl-2-pyridinyl)carbamothioic S-acid?
The canonical SMILES for carbamothioic S-acid;N,N-diethylethanamine;(6-methyl-2-pyridinyl)carbamothioic S-acid is CCN(CC)CC.Cc1cccc(NC(=O)S)n1.NC(=O)S.
What is the InChIKey of carbamothioic S-acid;N,N-diethylethanamine;(6-methyl-2-pyridinyl)carbamothioic S-acid?
The InChIKey is FDVCHEGOKYBNQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2OS.C6H15N.CH3NOS/c1-5-3-2-4-6(8-5)9-7(10)11;1-4-7(5-2)6-3;2-1(3)4/h2-4H,1H3,(H2,8,9,10,11);4-6H2,1-3H3;(H3,2,3,4).
What are the key properties of carbamothioic S-acid;N,N-diethylethanamine;(6-methyl-2-pyridinyl)carbamothioic S-acid?
carbamothioic S-acid;N,N-diethylethanamine;(6-methyl-2-pyridinyl)carbamothioic S-acid has a molecular weight of 346.52 g/mol, XLogP of 3.19, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbamothioic S-acid;N,N-diethylethanamine;(6-methyl-2-pyridinyl)carbamothioic S-acid is sourced from PubChem (CID 88793272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).