C24H39N3O4S — CID 88793451
(Z)-7-[(1R,2R,3R)-2-[(E)-3-(1-butylcyclobutyl)-3-hydroxyprop-1-enyl]-5-(carbamothioylhydrazinylidene)-3-hydroxycyclopentyl]hept-5-enoic acid (PubChem CID 88793451) has the molecular formula C24H39N3O4S and a molecular weight of 465.66 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R)-2-[(E)-3-(1-butylcyclobutyl)-3-hydroxyprop-1-enyl]-5-(carbamothioylhydrazinylidene)-3-hydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R)-2-[(E)-3-(1-butylcyclobutyl)-3-hydroxyprop-1-enyl]-5-(carbamothioylhydrazinylidene)-3-hydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 88793451 |
| Molecular Formula | C24H39N3O4S |
| Molecular Weight | 465.66 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | (Z)-7-[(1R,2R,3R)-2-[(E)-3-(1-butylcyclobutyl)-3-hydroxyprop-1-enyl]-5-(carbamothioylhydrazinylidene)-3-hydroxycyclopentyl]hept-5-enoic acid |
| SMILES | CCCCC1(C(O)/C=C/[C@H]2[C@H](O)CC(=NNC(N)=S)[C@@H]2C/C=C\CCCC(=O)O)CCC1 |
| InChI | InChI=1S/C24H39N3O4S/c1-2-3-13-24(14-8-15-24)21(29)12-11-18-17(9-6-4-5-7-10-22(30)31)19(16-20(18)28)26-27-23(25)32/h4,6,11-12,17-18,20-21,28-29H,2-3,5,7-10,13-16H2,1H3,(H,30,31)(H3,25,27,32)/b6-4-,12-11+,26-19?/t17-,18-,20-,21?/m1/s1 |
| InChIKey | HMGBCNYETZXWLM-XLOIRHDPSA-N |
| XLogP | 3.65 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.66 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|