About 1,4-dichlorocyclohexa-2,4-diene-1-sulfonyl chloride
1,4-dichlorocyclohexa-2,4-diene-1-sulfonyl chloride (PubChem CID 88793971) has the molecular formula C6H5Cl3O2S
and a molecular weight of 247.53 g/mol. Its IUPAC name is 1,4-dichlorocyclohexa-2,4-diene-1-sulfonyl chloride.
Molecular Properties
| Compound Name | 1,4-dichlorocyclohexa-2,4-diene-1-sulfonyl chloride |
| PubChem CID | 88793971 |
| Molecular Formula | C6H5Cl3O2S |
| Molecular Weight | 247.53 g/mol |
| Exact Mass | 245.91 |
| IUPAC Name | 1,4-dichlorocyclohexa-2,4-diene-1-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)C1(Cl)C=CC(Cl)=CC1 |
| InChI | InChI=1S/C6H5Cl3O2S/c7-5-1-3-6(8,4-2-5)12(9,10)11/h1-3H,4H2 |
| InChIKey | GMYZCRFORAQCER-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.53 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dichlorocyclohexa-2,4-diene-1-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dichlorocyclohexa-2,4-diene-1-sulfonyl chloride?
The IUPAC name of 1,4-dichlorocyclohexa-2,4-diene-1-sulfonyl chloride (CID 88793971) is 1,4-dichlorocyclohexa-2,4-diene-1-sulfonyl chloride.
What is the SMILES notation for 1,4-dichlorocyclohexa-2,4-diene-1-sulfonyl chloride?
The canonical SMILES for 1,4-dichlorocyclohexa-2,4-diene-1-sulfonyl chloride is O=S(=O)(Cl)C1(Cl)C=CC(Cl)=CC1.
What is the InChIKey of 1,4-dichlorocyclohexa-2,4-diene-1-sulfonyl chloride?
The InChIKey is GMYZCRFORAQCER-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Cl3O2S/c7-5-1-3-6(8,4-2-5)12(9,10)11/h1-3H,4H2.
What are the key properties of 1,4-dichlorocyclohexa-2,4-diene-1-sulfonyl chloride?
1,4-dichlorocyclohexa-2,4-diene-1-sulfonyl chloride has a molecular weight of 247.53 g/mol, XLogP of 2.57, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dichlorocyclohexa-2,4-diene-1-sulfonyl chloride is sourced from PubChem (CID 88793971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).