C13H18N3O2PS2 — CID 88794062
1-[(4-cyanophenyl)methyl]-3-[ethoxy(ethylsulfanyl)phosphoryl]thiourea (PubChem CID 88794062) has the molecular formula C13H18N3O2PS2 and a molecular weight of 343.41 g/mol. Its IUPAC name is 1-[(4-cyanophenyl)methyl]-3-[ethoxy(ethylsulfanyl)phosphoryl]thiourea.
| Compound Name | 1-[(4-cyanophenyl)methyl]-3-[ethoxy(ethylsulfanyl)phosphoryl]thiourea |
|---|---|
| PubChem CID | 88794062 |
| Molecular Formula | C13H18N3O2PS2 |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 1-[(4-cyanophenyl)methyl]-3-[ethoxy(ethylsulfanyl)phosphoryl]thiourea |
| SMILES | CCOP(=O)(NC(=S)NCc1ccc(C#N)cc1)SCC |
| InChI | InChI=1S/C13H18N3O2PS2/c1-3-18-19(17,21-4-2)16-13(20)15-10-12-7-5-11(9-14)6-8-12/h5-8H,3-4,10H2,1-2H3,(H2,15,16,17,20) |
| InChIKey | XYDGNSVRYZJDDY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|