C14H22O3 — CID 88794074
(2E,4E,6E)-8,8-diethoxy-3,7-dimethylocta-2,4,6-trienal (PubChem CID 88794074) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is (2E,4E,6E)-8,8-diethoxy-3,7-dimethylocta-2,4,6-trienal.
| Compound Name | (2E,4E,6E)-8,8-diethoxy-3,7-dimethylocta-2,4,6-trienal |
|---|---|
| PubChem CID | 88794074 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (2E,4E,6E)-8,8-diethoxy-3,7-dimethylocta-2,4,6-trienal |
| SMILES | CCOC(OCC)/C(C)=C/C=C/C(C)=C/C=O |
| InChI | InChI=1S/C14H22O3/c1-5-16-14(17-6-2)13(4)9-7-8-12(3)10-11-15/h7-11,14H,5-6H2,1-4H3/b8-7+,12-10+,13-9+ |
| InChIKey | PCYSRECLJVMEPX-YLQIKPOOSA-N |
| XLogP | 3.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|