sodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane

C6H14NaO2PS2 — CID 88794363

IUPACsodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane
SMILESCCCOP([O-])(=S)SCCC.[Na+]
InChIInChI=1S/C6H15O2PS2.Na/c1-3-5-8-9(7,10)11-6-4-2;/h3-6H2,1-2H3,(H,7,10);/q;+1/p-1
InChIKeyQSXAOOWUVTVWBZ-UHFFFAOYSA-M
MW236.27 g/mol
LogP-0.86
Rot. Bonds6

About sodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane

sodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane (PubChem CID 88794363) has the molecular formula C6H14NaO2PS2 and a molecular weight of 236.27 g/mol. Its IUPAC name is sodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane.

Molecular Properties

Compound Namesodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane
PubChem CID88794363
Molecular FormulaC6H14NaO2PS2
Molecular Weight236.27 g/mol
Exact Mass236.01
IUPAC Namesodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane
SMILESCCCOP([O-])(=S)SCCC.[Na+]
InChIInChI=1S/C6H15O2PS2.Na/c1-3-5-8-9(7,10)11-6-4-2;/h3-6H2,1-2H3,(H,7,10);/q;+1/p-1
InChIKeyQSXAOOWUVTVWBZ-UHFFFAOYSA-M
XLogP-0.86
TPSA32.29 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.27
LogP ≤ 5-0.86
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze sodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane?
The IUPAC name of sodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane (CID 88794363) is sodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane.
What is the SMILES notation for sodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane?
The canonical SMILES for sodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane is CCCOP([O-])(=S)SCCC.[Na+].
What is the InChIKey of sodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane?
The InChIKey is QSXAOOWUVTVWBZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H15O2PS2.Na/c1-3-5-8-9(7,10)11-6-4-2;/h3-6H2,1-2H3,(H,7,10);/q;+1/p-1.
What are the key properties of sodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane?
sodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane has a molecular weight of 236.27 g/mol, XLogP of -0.86, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane is sourced from PubChem (CID 88794363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).