About sodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane
sodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane (PubChem CID 88794363) has the molecular formula C6H14NaO2PS2
and a molecular weight of 236.27 g/mol. Its IUPAC name is sodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane.
Molecular Properties
| Compound Name | sodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane |
| PubChem CID | 88794363 |
| Molecular Formula | C6H14NaO2PS2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.01 |
| IUPAC Name | sodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane |
| SMILES | CCCOP([O-])(=S)SCCC.[Na+] |
| InChI | InChI=1S/C6H15O2PS2.Na/c1-3-5-8-9(7,10)11-6-4-2;/h3-6H2,1-2H3,(H,7,10);/q;+1/p-1 |
| InChIKey | QSXAOOWUVTVWBZ-UHFFFAOYSA-M |
| XLogP | -0.86 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane?
The IUPAC name of sodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane (CID 88794363) is sodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane.
What is the SMILES notation for sodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane?
The canonical SMILES for sodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane is CCCOP([O-])(=S)SCCC.[Na+].
What is the InChIKey of sodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane?
The InChIKey is QSXAOOWUVTVWBZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H15O2PS2.Na/c1-3-5-8-9(7,10)11-6-4-2;/h3-6H2,1-2H3,(H,7,10);/q;+1/p-1.
What are the key properties of sodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane?
sodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane has a molecular weight of 236.27 g/mol, XLogP of -0.86, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane is sourced from PubChem (CID 88794363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).