About [(1-tert-butylsulfanyl-3,3-dimethylbutan-2-ylidene)amino] N-methylcarbamate
[(1-tert-butylsulfanyl-3,3-dimethylbutan-2-ylidene)amino] N-methylcarbamate (PubChem CID 88794425) has the molecular formula C12H24N2O2S
and a molecular weight of 260.40 g/mol. Its IUPAC name is [(1-tert-butylsulfanyl-3,3-dimethylbutan-2-ylidene)amino] N-methylcarbamate.
Molecular Properties
| Compound Name | [(1-tert-butylsulfanyl-3,3-dimethylbutan-2-ylidene)amino] N-methylcarbamate |
| PubChem CID | 88794425 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | [(1-tert-butylsulfanyl-3,3-dimethylbutan-2-ylidene)amino] N-methylcarbamate |
| SMILES | CNC(=O)ON=C(CSC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H24N2O2S/c1-11(2,3)9(8-17-12(4,5)6)14-16-10(15)13-7/h8H2,1-7H3,(H,13,15) |
| InChIKey | HBXOZRYHGKYTOR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1-tert-butylsulfanyl-3,3-dimethylbutan-2-ylidene)amino] N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1-tert-butylsulfanyl-3,3-dimethylbutan-2-ylidene)amino] N-methylcarbamate?
The IUPAC name of [(1-tert-butylsulfanyl-3,3-dimethylbutan-2-ylidene)amino] N-methylcarbamate (CID 88794425) is [(1-tert-butylsulfanyl-3,3-dimethylbutan-2-ylidene)amino] N-methylcarbamate.
What is the SMILES notation for [(1-tert-butylsulfanyl-3,3-dimethylbutan-2-ylidene)amino] N-methylcarbamate?
The canonical SMILES for [(1-tert-butylsulfanyl-3,3-dimethylbutan-2-ylidene)amino] N-methylcarbamate is CNC(=O)ON=C(CSC(C)(C)C)C(C)(C)C.
What is the InChIKey of [(1-tert-butylsulfanyl-3,3-dimethylbutan-2-ylidene)amino] N-methylcarbamate?
The InChIKey is HBXOZRYHGKYTOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2S/c1-11(2,3)9(8-17-12(4,5)6)14-16-10(15)13-7/h8H2,1-7H3,(H,13,15).
What are the key properties of [(1-tert-butylsulfanyl-3,3-dimethylbutan-2-ylidene)amino] N-methylcarbamate?
[(1-tert-butylsulfanyl-3,3-dimethylbutan-2-ylidene)amino] N-methylcarbamate has a molecular weight of 260.40 g/mol, XLogP of 3.28, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1-tert-butylsulfanyl-3,3-dimethylbutan-2-ylidene)amino] N-methylcarbamate is sourced from PubChem (CID 88794425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).