C19H27Cl2N2O+ — CID 88794531
N-[(1R,2S)-2-(3,4-dichlorophenyl)-2-(1-methylpyrrolidin-1-ium-1-yl)cyclohexyl]acetamide (PubChem CID 88794531) has the molecular formula C19H27Cl2N2O+ and a molecular weight of 370.34 g/mol. Its IUPAC name is N-[(1R,2S)-2-(3,4-dichlorophenyl)-2-(1-methylpyrrolidin-1-ium-1-yl)cyclohexyl]acetamide.
| Compound Name | N-[(1R,2S)-2-(3,4-dichlorophenyl)-2-(1-methylpyrrolidin-1-ium-1-yl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 88794531 |
| Molecular Formula | C19H27Cl2N2O+ |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-[(1R,2S)-2-(3,4-dichlorophenyl)-2-(1-methylpyrrolidin-1-ium-1-yl)cyclohexyl]acetamide |
| SMILES | CC(=O)N[C@@H]1CCCC[C@@]1(c1ccc(Cl)c(Cl)c1)[N+]1(C)CCCC1 |
| InChI | InChI=1S/C19H26Cl2N2O/c1-14(24)22-18-7-3-4-10-19(18,23(2)11-5-6-12-23)15-8-9-16(20)17(21)13-15/h8-9,13,18H,3-7,10-12H2,1-2H3/p+1/t18-,19+/m1/s1 |
| InChIKey | SWWBOXNJGQFWER-MOPGFXCFSA-O |
| XLogP | 4.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|