C21H26O3 — CID 88794782
(8R,9R,10S,13S,14S)-10-(hydroxymethyl)-13-methyl-1,2-dimethylidene-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 88794782) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S)-10-(hydroxymethyl)-13-methyl-1,2-dimethylidene-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9R,10S,13S,14S)-10-(hydroxymethyl)-13-methyl-1,2-dimethylidene-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 88794782 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (8R,9R,10S,13S,14S)-10-(hydroxymethyl)-13-methyl-1,2-dimethylidene-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C=C1C(=C)[C@@]2(CO)C(=CC1=O)CC[C@@H]1[C@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C21H26O3/c1-12-13(2)21(11-22)14(10-18(12)23)4-5-15-16-6-7-19(24)20(16,3)9-8-17(15)21/h10,15-17,22H,1-2,4-9,11H2,3H3/t15-,16-,17+,20-,21-/m0/s1 |
| InChIKey | FRYYDQVKEOFFDA-QIBQCXCESA-N |
| XLogP | 3.39 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|