C7H11N7O — CID 88795112
buta-2,3-dienamide;1,3,5-triazine-2,4,6-triamine (PubChem CID 88795112) has the molecular formula C7H11N7O and a molecular weight of 209.21 g/mol. Its IUPAC name is buta-2,3-dienamide;1,3,5-triazine-2,4,6-triamine.
| Compound Name | buta-2,3-dienamide;1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 88795112 |
| Molecular Formula | C7H11N7O |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | buta-2,3-dienamide;1,3,5-triazine-2,4,6-triamine |
| SMILES | C=C=CC(N)=O.Nc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C4H5NO.C3H6N6/c1-2-3-4(5)6;4-1-7-2(5)9-3(6)8-1/h3H,1H2,(H2,5,6);(H6,4,5,6,7,8,9) |
| InChIKey | HYPDEBDARUMRHM-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|