About 7-bromo-3-oxido-4H-1,3-benzoxazin-2-one
7-bromo-3-oxido-4H-1,3-benzoxazin-2-one (PubChem CID 88795550) has the molecular formula C8H5BrNO3-
and a molecular weight of 243.04 g/mol. Its IUPAC name is 7-bromo-3-oxido-4H-1,3-benzoxazin-2-one.
Molecular Properties
| Compound Name | 7-bromo-3-oxido-4H-1,3-benzoxazin-2-one |
| PubChem CID | 88795550 |
| Molecular Formula | C8H5BrNO3- |
| Molecular Weight | 243.04 g/mol |
| Exact Mass | 241.95 |
| IUPAC Name | 7-bromo-3-oxido-4H-1,3-benzoxazin-2-one |
| SMILES | O=C1Oc2cc(Br)ccc2CN1[O-] |
| InChI | InChI=1S/C8H5BrNO3/c9-6-2-1-5-4-10(12)8(11)13-7(5)3-6/h1-3H,4H2/q-1 |
| InChIKey | BMBQQOKFKRCDID-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.04 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-bromo-3-oxido-4H-1,3-benzoxazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-3-oxido-4H-1,3-benzoxazin-2-one?
The IUPAC name of 7-bromo-3-oxido-4H-1,3-benzoxazin-2-one (CID 88795550) is 7-bromo-3-oxido-4H-1,3-benzoxazin-2-one.
What is the SMILES notation for 7-bromo-3-oxido-4H-1,3-benzoxazin-2-one?
The canonical SMILES for 7-bromo-3-oxido-4H-1,3-benzoxazin-2-one is O=C1Oc2cc(Br)ccc2CN1[O-].
What is the InChIKey of 7-bromo-3-oxido-4H-1,3-benzoxazin-2-one?
The InChIKey is BMBQQOKFKRCDID-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrNO3/c9-6-2-1-5-4-10(12)8(11)13-7(5)3-6/h1-3H,4H2/q-1.
What are the key properties of 7-bromo-3-oxido-4H-1,3-benzoxazin-2-one?
7-bromo-3-oxido-4H-1,3-benzoxazin-2-one has a molecular weight of 243.04 g/mol, XLogP of 2.26, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-3-oxido-4H-1,3-benzoxazin-2-one is sourced from PubChem (CID 88795550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).