C28H55NO — CID 88795597
(Z)-N,N-bis(3-methylbutyl)octadec-9-enamide (PubChem CID 88795597) has the molecular formula C28H55NO and a molecular weight of 421.75 g/mol. Its IUPAC name is (Z)-N,N-bis(3-methylbutyl)octadec-9-enamide.
| Compound Name | (Z)-N,N-bis(3-methylbutyl)octadec-9-enamide |
|---|---|
| PubChem CID | 88795597 |
| Molecular Formula | C28H55NO |
| Molecular Weight | 421.75 g/mol |
| Exact Mass | 421.43 |
| IUPAC Name | (Z)-N,N-bis(3-methylbutyl)octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N(CCC(C)C)CCC(C)C |
| InChI | InChI=1S/C28H55NO/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-28(30)29(24-22-26(2)3)25-23-27(4)5/h13-14,26-27H,6-12,15-25H2,1-5H3/b14-13- |
| InChIKey | OLGKGRZRNDGWFM-YPKPFQOOSA-N |
| XLogP | 8.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.75 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|