About N,N-diisoamyloleamide
N,N-diisoamyloleamide (PubChem CID 88795597) has the molecular formula C28H55NO
and a molecular weight of 421.70 g/mol. Its IUPAC name is (Z)-N,N-bis(3-methylbutyl)octadec-9-enamide.
Molecular Properties
| Compound Name | N,N-diisoamyloleamide |
| PubChem CID | 88795597 |
| Molecular Formula | C28H55NO |
| Molecular Weight | 421.70 g/mol |
| Exact Mass | 421.43 |
| IUPAC Name | (Z)-N,N-bis(3-methylbutyl)octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N(CCC(C)C)CCC(C)C |
| InChI | InChI=1S/C28H55NO/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-28(30)29(24-22-26(2)3)25-23-27(4)5/h13-14,26-27H,6-12,15-25H2,1-5H3/b14-13- |
| InChIKey | OLGKGRZRNDGWFM-YPKPFQOOSA-N |
| XLogP | 10.60 |
| TPSA | 20.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | 387 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.70 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,N-diisoamyloleamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diisoamyloleamide?
The IUPAC name of N,N-diisoamyloleamide (CID 88795597) is (Z)-N,N-bis(3-methylbutyl)octadec-9-enamide.
What is the SMILES notation for N,N-diisoamyloleamide?
The canonical SMILES for N,N-diisoamyloleamide is CCCCCCCC/C=C\CCCCCCCC(=O)N(CCC(C)C)CCC(C)C.
What is the InChIKey of N,N-diisoamyloleamide?
The InChIKey is OLGKGRZRNDGWFM-YPKPFQOOSA-N. The full InChI is InChI=1S/C28H55NO/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-28(30)29(24-22-26(2)3)25-23-27(4)5/h13-14,26-27H,6-12,15-25H2,1-5H3/b14-13-.
What are the key properties of N,N-diisoamyloleamide?
N,N-diisoamyloleamide has a molecular weight of 421.70 g/mol, XLogP of 10.60, 21 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diisoamyloleamide is sourced from PubChem (CID 88795597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).