About 1,2-dimethyl-4,5-dihydroimidazole-4-thiol
1,2-dimethyl-4,5-dihydroimidazole-4-thiol (PubChem CID 88795812) has the molecular formula C5H10N2S
and a molecular weight of 130.22 g/mol. Its IUPAC name is 1,2-dimethyl-4,5-dihydroimidazole-4-thiol.
Molecular Properties
| Compound Name | 1,2-dimethyl-4,5-dihydroimidazole-4-thiol |
| PubChem CID | 88795812 |
| Molecular Formula | C5H10N2S |
| Molecular Weight | 130.22 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | 1,2-dimethyl-4,5-dihydroimidazole-4-thiol |
| SMILES | CC1=NC(S)CN1C |
| InChI | InChI=1S/C5H10N2S/c1-4-6-5(8)3-7(4)2/h5,8H,3H2,1-2H3 |
| InChIKey | BLNJNQKFAUGHFY-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 15.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.22 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethyl-4,5-dihydroimidazole-4-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-4,5-dihydroimidazole-4-thiol?
The IUPAC name of 1,2-dimethyl-4,5-dihydroimidazole-4-thiol (CID 88795812) is 1,2-dimethyl-4,5-dihydroimidazole-4-thiol.
What is the SMILES notation for 1,2-dimethyl-4,5-dihydroimidazole-4-thiol?
The canonical SMILES for 1,2-dimethyl-4,5-dihydroimidazole-4-thiol is CC1=NC(S)CN1C.
What is the InChIKey of 1,2-dimethyl-4,5-dihydroimidazole-4-thiol?
The InChIKey is BLNJNQKFAUGHFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2S/c1-4-6-5(8)3-7(4)2/h5,8H,3H2,1-2H3.
What are the key properties of 1,2-dimethyl-4,5-dihydroimidazole-4-thiol?
1,2-dimethyl-4,5-dihydroimidazole-4-thiol has a molecular weight of 130.22 g/mol, XLogP of 0.61, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-4,5-dihydroimidazole-4-thiol is sourced from PubChem (CID 88795812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).