About trimethylstannyl 3-sulfanylhex-5-enoate
trimethylstannyl 3-sulfanylhex-5-enoate (PubChem CID 88795919) has the molecular formula C9H18O2SSn
and a molecular weight of 309.02 g/mol. Its IUPAC name is trimethylstannyl 3-sulfanylhex-5-enoate.
Molecular Properties
| Compound Name | trimethylstannyl 3-sulfanylhex-5-enoate |
| PubChem CID | 88795919 |
| Molecular Formula | C9H18O2SSn |
| Molecular Weight | 309.02 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | trimethylstannyl 3-sulfanylhex-5-enoate |
| SMILES | C=CCC(S)CC(=O)O[Sn](C)(C)C |
| InChI | InChI=1S/C6H10O2S.3CH3.Sn/c1-2-3-5(9)4-6(7)8;;;;/h2,5,9H,1,3-4H2,(H,7,8);3*1H3;/q;;;;+1/p-1 |
| InChIKey | FOTUCEJIFBTXSB-UHFFFAOYSA-M |
| XLogP | 2.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.02 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze trimethylstannyl 3-sulfanylhex-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylstannyl 3-sulfanylhex-5-enoate?
The IUPAC name of trimethylstannyl 3-sulfanylhex-5-enoate (CID 88795919) is trimethylstannyl 3-sulfanylhex-5-enoate.
What is the SMILES notation for trimethylstannyl 3-sulfanylhex-5-enoate?
The canonical SMILES for trimethylstannyl 3-sulfanylhex-5-enoate is C=CCC(S)CC(=O)O[Sn](C)(C)C.
What is the InChIKey of trimethylstannyl 3-sulfanylhex-5-enoate?
The InChIKey is FOTUCEJIFBTXSB-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H10O2S.3CH3.Sn/c1-2-3-5(9)4-6(7)8;;;;/h2,5,9H,1,3-4H2,(H,7,8);3*1H3;/q;;;;+1/p-1.
What are the key properties of trimethylstannyl 3-sulfanylhex-5-enoate?
trimethylstannyl 3-sulfanylhex-5-enoate has a molecular weight of 309.02 g/mol, XLogP of 2.63, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylstannyl 3-sulfanylhex-5-enoate is sourced from PubChem (CID 88795919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).