C16H21NO4S2 — CID 88796179
(2S,4R)-4-hydroxy-1-[2-methyl-3-[(4-methylphenyl)disulfanyl]propanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 88796179) has the molecular formula C16H21NO4S2 and a molecular weight of 355.48 g/mol. Its IUPAC name is (2S,4R)-4-hydroxy-1-[2-methyl-3-[(4-methylphenyl)disulfanyl]propanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4R)-4-hydroxy-1-[2-methyl-3-[(4-methylphenyl)disulfanyl]propanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 88796179 |
| Molecular Formula | C16H21NO4S2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | (2S,4R)-4-hydroxy-1-[2-methyl-3-[(4-methylphenyl)disulfanyl]propanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | Cc1ccc(SSCC(C)C(=O)N2C[C@H](O)C[C@H]2C(=O)O)cc1 |
| InChI | InChI=1S/C16H21NO4S2/c1-10-3-5-13(6-4-10)23-22-9-11(2)15(19)17-8-12(18)7-14(17)16(20)21/h3-6,11-12,14,18H,7-9H2,1-2H3,(H,20,21)/t11?,12-,14+/m1/s1 |
| InChIKey | GAGCJEGJGSFRBU-AOUZGSJDSA-N |
| XLogP | 2.42 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|