About 1,3-dichloro-1-(1,3-dichloropropylsulfonyl)propane
1,3-dichloro-1-(1,3-dichloropropylsulfonyl)propane (PubChem CID 88796251) has the molecular formula C6H10Cl4O2S
and a molecular weight of 288.02 g/mol. Its IUPAC name is 1,3-dichloro-1-(1,3-dichloropropylsulfonyl)propane.
Molecular Properties
| Compound Name | 1,3-dichloro-1-(1,3-dichloropropylsulfonyl)propane |
| PubChem CID | 88796251 |
| Molecular Formula | C6H10Cl4O2S |
| Molecular Weight | 288.02 g/mol |
| Exact Mass | 285.92 |
| IUPAC Name | 1,3-dichloro-1-(1,3-dichloropropylsulfonyl)propane |
| SMILES | O=S(=O)(C(Cl)CCCl)C(Cl)CCCl |
| InChI | InChI=1S/C6H10Cl4O2S/c7-3-1-5(9)13(11,12)6(10)2-4-8/h5-6H,1-4H2 |
| InChIKey | ZCPYWUZYRJZBKC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.02 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dichloro-1-(1,3-dichloropropylsulfonyl)propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dichloro-1-(1,3-dichloropropylsulfonyl)propane?
The IUPAC name of 1,3-dichloro-1-(1,3-dichloropropylsulfonyl)propane (CID 88796251) is 1,3-dichloro-1-(1,3-dichloropropylsulfonyl)propane.
What is the SMILES notation for 1,3-dichloro-1-(1,3-dichloropropylsulfonyl)propane?
The canonical SMILES for 1,3-dichloro-1-(1,3-dichloropropylsulfonyl)propane is O=S(=O)(C(Cl)CCCl)C(Cl)CCCl.
What is the InChIKey of 1,3-dichloro-1-(1,3-dichloropropylsulfonyl)propane?
The InChIKey is ZCPYWUZYRJZBKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10Cl4O2S/c7-3-1-5(9)13(11,12)6(10)2-4-8/h5-6H,1-4H2.
What are the key properties of 1,3-dichloro-1-(1,3-dichloropropylsulfonyl)propane?
1,3-dichloro-1-(1,3-dichloropropylsulfonyl)propane has a molecular weight of 288.02 g/mol, XLogP of 2.79, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dichloro-1-(1,3-dichloropropylsulfonyl)propane is sourced from PubChem (CID 88796251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).