About calcium bis(3,4-bis(prop-2-enoylamino)benzenesulfonate)
calcium bis(3,4-bis(prop-2-enoylamino)benzenesulfonate) (PubChem CID 88796293) has the molecular formula C24H22CaN4O10S2
and a molecular weight of 630.67 g/mol. Its IUPAC name is calcium bis(3,4-bis(prop-2-enoylamino)benzenesulfonate).
Molecular Properties
| Compound Name | calcium bis(3,4-bis(prop-2-enoylamino)benzenesulfonate) |
| PubChem CID | 88796293 |
| Molecular Formula | C24H22CaN4O10S2 |
| Molecular Weight | 630.67 g/mol |
| Exact Mass | 630.04 |
| IUPAC Name | calcium bis(3,4-bis(prop-2-enoylamino)benzenesulfonate) |
| SMILES | C=CC(=O)Nc1ccc(S(=O)(=O)[O-])cc1NC(=O)C=C.C=CC(=O)Nc1ccc(S(=O)(=O)[O-])cc1NC(=O)C=C.[Ca+2] |
| InChI | InChI=1S/2C12H12N2O5S.Ca/c2*1-3-11(15)13-9-6-5-8(20(17,18)19)7-10(9)14-12(16)4-2;/h2*3-7H,1-2H2,(H,13,15)(H,14,16)(H,17,18,19);/q;;+2/p-2 |
| InChIKey | LKXMCZMYXGBDPC-UHFFFAOYSA-L |
| XLogP | 1.30 |
| TPSA | 230.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 630.67 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze calcium bis(3,4-bis(prop-2-enoylamino)benzenesulfonate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium bis(3,4-bis(prop-2-enoylamino)benzenesulfonate)?
The IUPAC name of calcium bis(3,4-bis(prop-2-enoylamino)benzenesulfonate) (CID 88796293) is calcium bis(3,4-bis(prop-2-enoylamino)benzenesulfonate).
What is the SMILES notation for calcium bis(3,4-bis(prop-2-enoylamino)benzenesulfonate)?
The canonical SMILES for calcium bis(3,4-bis(prop-2-enoylamino)benzenesulfonate) is C=CC(=O)Nc1ccc(S(=O)(=O)[O-])cc1NC(=O)C=C.C=CC(=O)Nc1ccc(S(=O)(=O)[O-])cc1NC(=O)C=C.[Ca+2].
What is the InChIKey of calcium bis(3,4-bis(prop-2-enoylamino)benzenesulfonate)?
The InChIKey is LKXMCZMYXGBDPC-UHFFFAOYSA-L. The full InChI is InChI=1S/2C12H12N2O5S.Ca/c2*1-3-11(15)13-9-6-5-8(20(17,18)19)7-10(9)14-12(16)4-2;/h2*3-7H,1-2H2,(H,13,15)(H,14,16)(H,17,18,19);/q;;+2/p-2.
What are the key properties of calcium bis(3,4-bis(prop-2-enoylamino)benzenesulfonate)?
calcium bis(3,4-bis(prop-2-enoylamino)benzenesulfonate) has a molecular weight of 630.67 g/mol, XLogP of 1.30, 10 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for calcium bis(3,4-bis(prop-2-enoylamino)benzenesulfonate) is sourced from PubChem (CID 88796293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).