About 6-[4-(3,5-ditert-butyl-4-hydroxyphenyl)sulfonylbutoxy]-1H-quinolin-2-one
6-[4-(3,5-ditert-butyl-4-hydroxyphenyl)sulfonylbutoxy]-1H-quinolin-2-one (PubChem CID 88796331) has the molecular formula C27H35NO5S
and a molecular weight of 485.65 g/mol. Its IUPAC name is 6-[4-(3,5-ditert-butyl-4-hydroxyphenyl)sulfonylbutoxy]-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 6-[4-(3,5-ditert-butyl-4-hydroxyphenyl)sulfonylbutoxy]-1H-quinolin-2-one |
| PubChem CID | 88796331 |
| Molecular Formula | C27H35NO5S |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 6-[4-(3,5-ditert-butyl-4-hydroxyphenyl)sulfonylbutoxy]-1H-quinolin-2-one |
| SMILES | CC(C)(C)c1cc(S(=O)(=O)CCCCOc2ccc3[nH]c(=O)ccc3c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C27H35NO5S/c1-26(2,3)21-16-20(17-22(25(21)30)27(4,5)6)34(31,32)14-8-7-13-33-19-10-11-23-18(15-19)9-12-24(29)28-23/h9-12,15-17,30H,7-8,13-14H2,1-6H3,(H,28,29) |
| InChIKey | AUYSXOJPAWORIE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 96.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[4-(3,5-ditert-butyl-4-hydroxyphenyl)sulfonylbutoxy]-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(3,5-ditert-butyl-4-hydroxyphenyl)sulfonylbutoxy]-1H-quinolin-2-one?
The IUPAC name of 6-[4-(3,5-ditert-butyl-4-hydroxyphenyl)sulfonylbutoxy]-1H-quinolin-2-one (CID 88796331) is 6-[4-(3,5-ditert-butyl-4-hydroxyphenyl)sulfonylbutoxy]-1H-quinolin-2-one.
What is the SMILES notation for 6-[4-(3,5-ditert-butyl-4-hydroxyphenyl)sulfonylbutoxy]-1H-quinolin-2-one?
The canonical SMILES for 6-[4-(3,5-ditert-butyl-4-hydroxyphenyl)sulfonylbutoxy]-1H-quinolin-2-one is CC(C)(C)c1cc(S(=O)(=O)CCCCOc2ccc3[nH]c(=O)ccc3c2)cc(C(C)(C)C)c1O.
What is the InChIKey of 6-[4-(3,5-ditert-butyl-4-hydroxyphenyl)sulfonylbutoxy]-1H-quinolin-2-one?
The InChIKey is AUYSXOJPAWORIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H35NO5S/c1-26(2,3)21-16-20(17-22(25(21)30)27(4,5)6)34(31,32)14-8-7-13-33-19-10-11-23-18(15-19)9-12-24(29)28-23/h9-12,15-17,30H,7-8,13-14H2,1-6H3,(H,28,29).
What are the key properties of 6-[4-(3,5-ditert-butyl-4-hydroxyphenyl)sulfonylbutoxy]-1H-quinolin-2-one?
6-[4-(3,5-ditert-butyl-4-hydroxyphenyl)sulfonylbutoxy]-1H-quinolin-2-one has a molecular weight of 485.65 g/mol, XLogP of 5.46, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(3,5-ditert-butyl-4-hydroxyphenyl)sulfonylbutoxy]-1H-quinolin-2-one is sourced from PubChem (CID 88796331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).