C12H23NO — CID 88796659
(E,3S)-N,N,3,7-tetramethyloct-4-enamide (PubChem CID 88796659) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is (E,3S)-N,N,3,7-tetramethyloct-4-enamide.
| Compound Name | (E,3S)-N,N,3,7-tetramethyloct-4-enamide |
|---|---|
| PubChem CID | 88796659 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (E,3S)-N,N,3,7-tetramethyloct-4-enamide |
| SMILES | CC(C)C/C=C/[C@@H](C)CC(=O)N(C)C |
| InChI | InChI=1S/C12H23NO/c1-10(2)7-6-8-11(3)9-12(14)13(4)5/h6,8,10-11H,7,9H2,1-5H3/b8-6+/t11-/m1/s1 |
| InChIKey | KVKSBBSIAKBAGH-LXSSAFMLSA-N |
| XLogP | 2.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|