2-ethyl-1,1-dimethylguanidine;sulfuric acid

C5H15N3O4S — CID 88796918

IUPAC2-ethyl-1,1-dimethylguanidine;sulfuric acid
SMILESCC/N=C(\N)N(C)C.O=S(=O)(O)O
InChIInChI=1S/C5H13N3.H2O4S/c1-4-7-5(6)8(2)3;1-5(2,3)4/h4H2,1-3H3,(H2,6,7);(H2,1,2,3,4)
InChIKeyPZJAARXCNWRONM-UHFFFAOYSA-N
MW213.26 g/mol
LogP-0.77
Rot. Bonds1

About 2-ethyl-1,1-dimethylguanidine;sulfuric acid

2-ethyl-1,1-dimethylguanidine;sulfuric acid (PubChem CID 88796918) has the molecular formula C5H15N3O4S and a molecular weight of 213.26 g/mol. Its IUPAC name is 2-ethyl-1,1-dimethylguanidine;sulfuric acid.

Molecular Properties

Compound Name2-ethyl-1,1-dimethylguanidine;sulfuric acid
PubChem CID88796918
Molecular FormulaC5H15N3O4S
Molecular Weight213.26 g/mol
Exact Mass213.08
IUPAC Name2-ethyl-1,1-dimethylguanidine;sulfuric acid
SMILESCC/N=C(\N)N(C)C.O=S(=O)(O)O
InChIInChI=1S/C5H13N3.H2O4S/c1-4-7-5(6)8(2)3;1-5(2,3)4/h4H2,1-3H3,(H2,6,7);(H2,1,2,3,4)
InChIKeyPZJAARXCNWRONM-UHFFFAOYSA-N
XLogP-0.77
TPSA116.22 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.26
LogP ≤ 5-0.77
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-ethyl-1,1-dimethylguanidine;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethyl-1,1-dimethylguanidine;sulfuric acid?
The IUPAC name of 2-ethyl-1,1-dimethylguanidine;sulfuric acid (CID 88796918) is 2-ethyl-1,1-dimethylguanidine;sulfuric acid.
What is the SMILES notation for 2-ethyl-1,1-dimethylguanidine;sulfuric acid?
The canonical SMILES for 2-ethyl-1,1-dimethylguanidine;sulfuric acid is CC/N=C(\N)N(C)C.O=S(=O)(O)O.
What is the InChIKey of 2-ethyl-1,1-dimethylguanidine;sulfuric acid?
The InChIKey is PZJAARXCNWRONM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N3.H2O4S/c1-4-7-5(6)8(2)3;1-5(2,3)4/h4H2,1-3H3,(H2,6,7);(H2,1,2,3,4).
What are the key properties of 2-ethyl-1,1-dimethylguanidine;sulfuric acid?
2-ethyl-1,1-dimethylguanidine;sulfuric acid has a molecular weight of 213.26 g/mol, XLogP of -0.77, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1,1-dimethylguanidine;sulfuric acid is sourced from PubChem (CID 88796918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).