C13H20N2O6S2 — CID 88796955
2-[3-[2-acetyloxy-2,2-bis(sulfanyl)ethyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]ethyl acetate (PubChem CID 88796955) has the molecular formula C13H20N2O6S2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 2-[3-[2-acetyloxy-2,2-bis(sulfanyl)ethyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]ethyl acetate.
| Compound Name | 2-[3-[2-acetyloxy-2,2-bis(sulfanyl)ethyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]ethyl acetate |
|---|---|
| PubChem CID | 88796955 |
| Molecular Formula | C13H20N2O6S2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 2-[3-[2-acetyloxy-2,2-bis(sulfanyl)ethyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]ethyl acetate |
| SMILES | CC(=O)OCCN1C(=O)N(CC(S)(S)OC(C)=O)C(C)(C)C1=O |
| InChI | InChI=1S/C13H20N2O6S2/c1-8(16)20-6-5-14-10(18)12(3,4)15(11(14)19)7-13(22,23)21-9(2)17/h22-23H,5-7H2,1-4H3 |
| InChIKey | YRUVILBGQQRDBO-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|