About 1-(2-methoxyphenoxy)-3,3-dimethyl-1-phenylurea
1-(2-methoxyphenoxy)-3,3-dimethyl-1-phenylurea (PubChem CID 88796958) has the molecular formula C16H18N2O3
and a molecular weight of 286.33 g/mol. Its IUPAC name is 1-(2-methoxyphenoxy)-3,3-dimethyl-1-phenylurea.
Molecular Properties
| Compound Name | 1-(2-methoxyphenoxy)-3,3-dimethyl-1-phenylurea |
| PubChem CID | 88796958 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 1-(2-methoxyphenoxy)-3,3-dimethyl-1-phenylurea |
| SMILES | COc1ccccc1ON(C(=O)N(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H18N2O3/c1-17(2)16(19)18(13-9-5-4-6-10-13)21-15-12-8-7-11-14(15)20-3/h4-12H,1-3H3 |
| InChIKey | KABUQXMBCNWDCB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methoxyphenoxy)-3,3-dimethyl-1-phenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxyphenoxy)-3,3-dimethyl-1-phenylurea?
The IUPAC name of 1-(2-methoxyphenoxy)-3,3-dimethyl-1-phenylurea (CID 88796958) is 1-(2-methoxyphenoxy)-3,3-dimethyl-1-phenylurea.
What is the SMILES notation for 1-(2-methoxyphenoxy)-3,3-dimethyl-1-phenylurea?
The canonical SMILES for 1-(2-methoxyphenoxy)-3,3-dimethyl-1-phenylurea is COc1ccccc1ON(C(=O)N(C)C)c1ccccc1.
What is the InChIKey of 1-(2-methoxyphenoxy)-3,3-dimethyl-1-phenylurea?
The InChIKey is KABUQXMBCNWDCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O3/c1-17(2)16(19)18(13-9-5-4-6-10-13)21-15-12-8-7-11-14(15)20-3/h4-12H,1-3H3.
What are the key properties of 1-(2-methoxyphenoxy)-3,3-dimethyl-1-phenylurea?
1-(2-methoxyphenoxy)-3,3-dimethyl-1-phenylurea has a molecular weight of 286.33 g/mol, XLogP of 3.18, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxyphenoxy)-3,3-dimethyl-1-phenylurea is sourced from PubChem (CID 88796958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).