About (Z)-3-butylsulfonyl-N,N-dimethylprop-2-en-1-amine
(Z)-3-butylsulfonyl-N,N-dimethylprop-2-en-1-amine (PubChem CID 88797014) has the molecular formula C9H19NO2S
and a molecular weight of 205.32 g/mol. Its IUPAC name is (Z)-3-butylsulfonyl-N,N-dimethylprop-2-en-1-amine.
Molecular Properties
| Compound Name | (Z)-3-butylsulfonyl-N,N-dimethylprop-2-en-1-amine |
| PubChem CID | 88797014 |
| Molecular Formula | C9H19NO2S |
| Molecular Weight | 205.32 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (Z)-3-butylsulfonyl-N,N-dimethylprop-2-en-1-amine |
| SMILES | CCCCS(=O)(=O)/C=C\CN(C)C |
| InChI | InChI=1S/C9H19NO2S/c1-4-5-8-13(11,12)9-6-7-10(2)3/h6,9H,4-5,7-8H2,1-3H3/b9-6- |
| InChIKey | UKBRKJYQIDOPHM-TWGQIWQCSA-N |
| XLogP | 1.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (Z)-3-butylsulfonyl-N,N-dimethylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-butylsulfonyl-N,N-dimethylprop-2-en-1-amine?
The IUPAC name of (Z)-3-butylsulfonyl-N,N-dimethylprop-2-en-1-amine (CID 88797014) is (Z)-3-butylsulfonyl-N,N-dimethylprop-2-en-1-amine.
What is the SMILES notation for (Z)-3-butylsulfonyl-N,N-dimethylprop-2-en-1-amine?
The canonical SMILES for (Z)-3-butylsulfonyl-N,N-dimethylprop-2-en-1-amine is CCCCS(=O)(=O)/C=C\CN(C)C.
What is the InChIKey of (Z)-3-butylsulfonyl-N,N-dimethylprop-2-en-1-amine?
The InChIKey is UKBRKJYQIDOPHM-TWGQIWQCSA-N. The full InChI is InChI=1S/C9H19NO2S/c1-4-5-8-13(11,12)9-6-7-10(2)3/h6,9H,4-5,7-8H2,1-3H3/b9-6-.
What are the key properties of (Z)-3-butylsulfonyl-N,N-dimethylprop-2-en-1-amine?
(Z)-3-butylsulfonyl-N,N-dimethylprop-2-en-1-amine has a molecular weight of 205.32 g/mol, XLogP of 1.28, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-butylsulfonyl-N,N-dimethylprop-2-en-1-amine is sourced from PubChem (CID 88797014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).