About 2-hept-3-ynylguanidine;sulfuric acid
2-hept-3-ynylguanidine;sulfuric acid (PubChem CID 88797273) has the molecular formula C8H17N3O4S
and a molecular weight of 251.31 g/mol. Its IUPAC name is 2-hept-3-ynylguanidine;sulfuric acid.
Molecular Properties
| Compound Name | 2-hept-3-ynylguanidine;sulfuric acid |
| PubChem CID | 88797273 |
| Molecular Formula | C8H17N3O4S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 2-hept-3-ynylguanidine;sulfuric acid |
| SMILES | CCCC#CCCN=C(N)N.O=S(=O)(O)O |
| InChI | InChI=1S/C8H15N3.H2O4S/c1-2-3-4-5-6-7-11-8(9)10;1-5(2,3)4/h2-3,6-7H2,1H3,(H4,9,10,11);(H2,1,2,3,4) |
| InChIKey | CHACIOBVUIQNKZ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hept-3-ynylguanidine;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hept-3-ynylguanidine;sulfuric acid?
The IUPAC name of 2-hept-3-ynylguanidine;sulfuric acid (CID 88797273) is 2-hept-3-ynylguanidine;sulfuric acid.
What is the SMILES notation for 2-hept-3-ynylguanidine;sulfuric acid?
The canonical SMILES for 2-hept-3-ynylguanidine;sulfuric acid is CCCC#CCCN=C(N)N.O=S(=O)(O)O.
What is the InChIKey of 2-hept-3-ynylguanidine;sulfuric acid?
The InChIKey is CHACIOBVUIQNKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3.H2O4S/c1-2-3-4-5-6-7-11-8(9)10;1-5(2,3)4/h2-3,6-7H2,1H3,(H4,9,10,11);(H2,1,2,3,4).
What are the key properties of 2-hept-3-ynylguanidine;sulfuric acid?
2-hept-3-ynylguanidine;sulfuric acid has a molecular weight of 251.31 g/mol, XLogP of -0.20, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hept-3-ynylguanidine;sulfuric acid is sourced from PubChem (CID 88797273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).