C18H18Cl3IN2O5S — CID 88797352
7-oxabicyclo[4.1.0]hepta-1,3,5-triene;1,2,2-trichloroethyl (5R)-2-acetamido-3-(iodomethyl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 88797352) has the molecular formula C18H18Cl3IN2O5S and a molecular weight of 607.68 g/mol. Its IUPAC name is 7-oxabicyclo[4.1.0]hepta-1,3,5-triene;1,2,2-trichloroethyl (5R)-2-acetamido-3-(iodomethyl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | 7-oxabicyclo[4.1.0]hepta-1,3,5-triene;1,2,2-trichloroethyl (5R)-2-acetamido-3-(iodomethyl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 88797352 |
| Molecular Formula | C18H18Cl3IN2O5S |
| Molecular Weight | 607.68 g/mol |
| Exact Mass | 605.90 |
| IUPAC Name | 7-oxabicyclo[4.1.0]hepta-1,3,5-triene;1,2,2-trichloroethyl (5R)-2-acetamido-3-(iodomethyl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC(=O)NC1(C(=O)OC(Cl)C(Cl)Cl)N2C(=O)C[C@H]2SC1(C)CI.c1ccc2c(c1)O2 |
| InChI | InChI=1S/C12H14Cl3IN2O4S.C6H4O/c1-5(19)17-12(10(21)22-9(15)8(13)14)11(2,4-16)23-7-3-6(20)18(7)12;1-2-4-6-5(3-1)7-6/h7-9H,3-4H2,1-2H3,(H,17,19);1-4H/t7-,9?,11?,12?;/m1./s1 |
| InChIKey | BNYAUDULQJVQBO-CJUQOQEKSA-N |
| XLogP | 4.02 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.68 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|