About 3-but-3-enyl-8-[6-(2-hydroxypropan-2-yl)-3-methyldec-9-enoxy]-2,6-dimethyloctan-2-ol
3-but-3-enyl-8-[6-(2-hydroxypropan-2-yl)-3-methyldec-9-enoxy]-2,6-dimethyloctan-2-ol (PubChem CID 88797726) has the molecular formula C28H54O3
and a molecular weight of 438.74 g/mol. Its IUPAC name is 3-but-3-enyl-8-[6-(2-hydroxypropan-2-yl)-3-methyldec-9-enoxy]-2,6-dimethyloctan-2-ol.
Molecular Properties
| Compound Name | 3-but-3-enyl-8-[6-(2-hydroxypropan-2-yl)-3-methyldec-9-enoxy]-2,6-dimethyloctan-2-ol |
| PubChem CID | 88797726 |
| Molecular Formula | C28H54O3 |
| Molecular Weight | 438.74 g/mol |
| Exact Mass | 438.41 |
| IUPAC Name | 3-but-3-enyl-8-[6-(2-hydroxypropan-2-yl)-3-methyldec-9-enoxy]-2,6-dimethyloctan-2-ol |
| SMILES | C=CCCC(CCC(C)CCOCCC(C)CCC(CCC=C)C(C)(C)O)C(C)(C)O |
| InChI | InChI=1S/C28H54O3/c1-9-11-13-25(27(5,6)29)17-15-23(3)19-21-31-22-20-24(4)16-18-26(14-12-10-2)28(7,8)30/h9-10,23-26,29-30H,1-2,11-22H2,3-8H3 |
| InChIKey | KRPHGWNJUMPURN-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.74 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-but-3-enyl-8-[6-(2-hydroxypropan-2-yl)-3-methyldec-9-enoxy]-2,6-dimethyloctan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-but-3-enyl-8-[6-(2-hydroxypropan-2-yl)-3-methyldec-9-enoxy]-2,6-dimethyloctan-2-ol?
The IUPAC name of 3-but-3-enyl-8-[6-(2-hydroxypropan-2-yl)-3-methyldec-9-enoxy]-2,6-dimethyloctan-2-ol (CID 88797726) is 3-but-3-enyl-8-[6-(2-hydroxypropan-2-yl)-3-methyldec-9-enoxy]-2,6-dimethyloctan-2-ol.
What is the SMILES notation for 3-but-3-enyl-8-[6-(2-hydroxypropan-2-yl)-3-methyldec-9-enoxy]-2,6-dimethyloctan-2-ol?
The canonical SMILES for 3-but-3-enyl-8-[6-(2-hydroxypropan-2-yl)-3-methyldec-9-enoxy]-2,6-dimethyloctan-2-ol is C=CCCC(CCC(C)CCOCCC(C)CCC(CCC=C)C(C)(C)O)C(C)(C)O.
What is the InChIKey of 3-but-3-enyl-8-[6-(2-hydroxypropan-2-yl)-3-methyldec-9-enoxy]-2,6-dimethyloctan-2-ol?
The InChIKey is KRPHGWNJUMPURN-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H54O3/c1-9-11-13-25(27(5,6)29)17-15-23(3)19-21-31-22-20-24(4)16-18-26(14-12-10-2)28(7,8)30/h9-10,23-26,29-30H,1-2,11-22H2,3-8H3.
What are the key properties of 3-but-3-enyl-8-[6-(2-hydroxypropan-2-yl)-3-methyldec-9-enoxy]-2,6-dimethyloctan-2-ol?
3-but-3-enyl-8-[6-(2-hydroxypropan-2-yl)-3-methyldec-9-enoxy]-2,6-dimethyloctan-2-ol has a molecular weight of 438.74 g/mol, XLogP of 7.32, 20 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-but-3-enyl-8-[6-(2-hydroxypropan-2-yl)-3-methyldec-9-enoxy]-2,6-dimethyloctan-2-ol is sourced from PubChem (CID 88797726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).