About 2-oxido-1,3-dihydropyridazin-6-one
2-oxido-1,3-dihydropyridazin-6-one (PubChem CID 88797762) has the molecular formula C4H5N2O2-
and a molecular weight of 113.10 g/mol. Its IUPAC name is 2-oxido-1,3-dihydropyridazin-6-one.
Molecular Properties
| Compound Name | 2-oxido-1,3-dihydropyridazin-6-one |
| PubChem CID | 88797762 |
| Molecular Formula | C4H5N2O2- |
| Molecular Weight | 113.10 g/mol |
| Exact Mass | 113.04 |
| IUPAC Name | 2-oxido-1,3-dihydropyridazin-6-one |
| SMILES | O=C1C=CCN([O-])N1 |
| InChI | InChI=1S/C4H5N2O2/c7-4-2-1-3-6(8)5-4/h1-2H,3H2,(H,5,7)/q-1 |
| InChIKey | AHPNJDDXHTYVCY-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.10 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-oxido-1,3-dihydropyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxido-1,3-dihydropyridazin-6-one?
The IUPAC name of 2-oxido-1,3-dihydropyridazin-6-one (CID 88797762) is 2-oxido-1,3-dihydropyridazin-6-one.
What is the SMILES notation for 2-oxido-1,3-dihydropyridazin-6-one?
The canonical SMILES for 2-oxido-1,3-dihydropyridazin-6-one is O=C1C=CCN([O-])N1.
What is the InChIKey of 2-oxido-1,3-dihydropyridazin-6-one?
The InChIKey is AHPNJDDXHTYVCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N2O2/c7-4-2-1-3-6(8)5-4/h1-2H,3H2,(H,5,7)/q-1.
What are the key properties of 2-oxido-1,3-dihydropyridazin-6-one?
2-oxido-1,3-dihydropyridazin-6-one has a molecular weight of 113.10 g/mol, XLogP of -0.61, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxido-1,3-dihydropyridazin-6-one is sourced from PubChem (CID 88797762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).