About 4-[3-(1,4-dioxan-2-yl)-1,4-dioxan-2-yl]butyl-triphenylphosphanium iodide
4-[3-(1,4-dioxan-2-yl)-1,4-dioxan-2-yl]butyl-triphenylphosphanium iodide (PubChem CID 88797770) has the molecular formula C30H36IO4P
and a molecular weight of 618.49 g/mol. Its IUPAC name is 4-[3-(1,4-dioxan-2-yl)-1,4-dioxan-2-yl]butyl-triphenylphosphanium iodide.
Molecular Properties
| Compound Name | 4-[3-(1,4-dioxan-2-yl)-1,4-dioxan-2-yl]butyl-triphenylphosphanium iodide |
| PubChem CID | 88797770 |
| Molecular Formula | C30H36IO4P |
| Molecular Weight | 618.49 g/mol |
| Exact Mass | 618.14 |
| IUPAC Name | 4-[3-(1,4-dioxan-2-yl)-1,4-dioxan-2-yl]butyl-triphenylphosphanium iodide |
| SMILES | [I-].c1ccc([P+](CCCCC2OCCOC2C2COCCO2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H36O4P.HI/c1-4-12-25(13-5-1)35(26-14-6-2-7-15-26,27-16-8-3-9-17-27)23-11-10-18-28-30(34-22-21-32-28)29-24-31-19-20-33-29;/h1-9,12-17,28-30H,10-11,18-24H2;1H/q+1;/p-1 |
| InChIKey | PCUKFJNLPUEHAL-UHFFFAOYSA-M |
| XLogP | 1.35 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 618.49 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(1,4-dioxan-2-yl)-1,4-dioxan-2-yl]butyl-triphenylphosphanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(1,4-dioxan-2-yl)-1,4-dioxan-2-yl]butyl-triphenylphosphanium iodide?
The IUPAC name of 4-[3-(1,4-dioxan-2-yl)-1,4-dioxan-2-yl]butyl-triphenylphosphanium iodide (CID 88797770) is 4-[3-(1,4-dioxan-2-yl)-1,4-dioxan-2-yl]butyl-triphenylphosphanium iodide.
What is the SMILES notation for 4-[3-(1,4-dioxan-2-yl)-1,4-dioxan-2-yl]butyl-triphenylphosphanium iodide?
The canonical SMILES for 4-[3-(1,4-dioxan-2-yl)-1,4-dioxan-2-yl]butyl-triphenylphosphanium iodide is [I-].c1ccc([P+](CCCCC2OCCOC2C2COCCO2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 4-[3-(1,4-dioxan-2-yl)-1,4-dioxan-2-yl]butyl-triphenylphosphanium iodide?
The InChIKey is PCUKFJNLPUEHAL-UHFFFAOYSA-M. The full InChI is InChI=1S/C30H36O4P.HI/c1-4-12-25(13-5-1)35(26-14-6-2-7-15-26,27-16-8-3-9-17-27)23-11-10-18-28-30(34-22-21-32-28)29-24-31-19-20-33-29;/h1-9,12-17,28-30H,10-11,18-24H2;1H/q+1;/p-1.
What are the key properties of 4-[3-(1,4-dioxan-2-yl)-1,4-dioxan-2-yl]butyl-triphenylphosphanium iodide?
4-[3-(1,4-dioxan-2-yl)-1,4-dioxan-2-yl]butyl-triphenylphosphanium iodide has a molecular weight of 618.49 g/mol, XLogP of 1.35, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(1,4-dioxan-2-yl)-1,4-dioxan-2-yl]butyl-triphenylphosphanium iodide is sourced from PubChem (CID 88797770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).