C16H17IN2O5S — CID 88797974
(5R)-2-acetamido-3-(iodomethyl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid;7-oxabicyclo[4.1.0]hepta-1,3,5-triene (PubChem CID 88797974) has the molecular formula C16H17IN2O5S and a molecular weight of 476.29 g/mol. Its IUPAC name is (5R)-2-acetamido-3-(iodomethyl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid;7-oxabicyclo[4.1.0]hepta-1,3,5-triene.
| Compound Name | (5R)-2-acetamido-3-(iodomethyl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid;7-oxabicyclo[4.1.0]hepta-1,3,5-triene |
|---|---|
| PubChem CID | 88797974 |
| Molecular Formula | C16H17IN2O5S |
| Molecular Weight | 476.29 g/mol |
| Exact Mass | 475.99 |
| IUPAC Name | (5R)-2-acetamido-3-(iodomethyl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid;7-oxabicyclo[4.1.0]hepta-1,3,5-triene |
| SMILES | CC(=O)NC1(C(=O)O)N2C(=O)C[C@H]2SC1(C)CI.c1ccc2c(c1)O2 |
| InChI | InChI=1S/C10H13IN2O4S.C6H4O/c1-5(14)12-10(8(16)17)9(2,4-11)18-7-3-6(15)13(7)10;1-2-4-6-5(3-1)7-6/h7H,3-4H2,1-2H3,(H,12,14)(H,16,17);1-4H/t7-,9?,10?;/m1./s1 |
| InChIKey | LFWMDBCWUGWFPL-WRCBSWFYSA-N |
| XLogP | 2.19 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|