About 2-[4-[4-[[[(E)-2-nitroethenyl]amino]methylamino]butyl]-1,3-thiazol-2-yl]guanidine
2-[4-[4-[[[(E)-2-nitroethenyl]amino]methylamino]butyl]-1,3-thiazol-2-yl]guanidine (PubChem CID 88798232) has the molecular formula C11H19N7O2S
and a molecular weight of 313.39 g/mol. Its IUPAC name is 2-[4-[4-[[[(E)-2-nitroethenyl]amino]methylamino]butyl]-1,3-thiazol-2-yl]guanidine.
Molecular Properties
| Compound Name | 2-[4-[4-[[[(E)-2-nitroethenyl]amino]methylamino]butyl]-1,3-thiazol-2-yl]guanidine |
| PubChem CID | 88798232 |
| Molecular Formula | C11H19N7O2S |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 2-[4-[4-[[[(E)-2-nitroethenyl]amino]methylamino]butyl]-1,3-thiazol-2-yl]guanidine |
| SMILES | NC(N)=Nc1nc(CCCCNCN/C=C/[N+](=O)[O-])cs1 |
| InChI | InChI=1S/C11H19N7O2S/c12-10(13)17-11-16-9(7-21-11)3-1-2-4-14-8-15-5-6-18(19)20/h5-7,14-15H,1-4,8H2,(H4,12,13,16,17)/b6-5+ |
| InChIKey | YOJCWVCRDPQAQK-AATRIKPKSA-N |
| XLogP | 0.26 |
| TPSA | 144.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[4-[[[(E)-2-nitroethenyl]amino]methylamino]butyl]-1,3-thiazol-2-yl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[4-[[[(E)-2-nitroethenyl]amino]methylamino]butyl]-1,3-thiazol-2-yl]guanidine?
The IUPAC name of 2-[4-[4-[[[(E)-2-nitroethenyl]amino]methylamino]butyl]-1,3-thiazol-2-yl]guanidine (CID 88798232) is 2-[4-[4-[[[(E)-2-nitroethenyl]amino]methylamino]butyl]-1,3-thiazol-2-yl]guanidine.
What is the SMILES notation for 2-[4-[4-[[[(E)-2-nitroethenyl]amino]methylamino]butyl]-1,3-thiazol-2-yl]guanidine?
The canonical SMILES for 2-[4-[4-[[[(E)-2-nitroethenyl]amino]methylamino]butyl]-1,3-thiazol-2-yl]guanidine is NC(N)=Nc1nc(CCCCNCN/C=C/[N+](=O)[O-])cs1.
What is the InChIKey of 2-[4-[4-[[[(E)-2-nitroethenyl]amino]methylamino]butyl]-1,3-thiazol-2-yl]guanidine?
The InChIKey is YOJCWVCRDPQAQK-AATRIKPKSA-N. The full InChI is InChI=1S/C11H19N7O2S/c12-10(13)17-11-16-9(7-21-11)3-1-2-4-14-8-15-5-6-18(19)20/h5-7,14-15H,1-4,8H2,(H4,12,13,16,17)/b6-5+.
What are the key properties of 2-[4-[4-[[[(E)-2-nitroethenyl]amino]methylamino]butyl]-1,3-thiazol-2-yl]guanidine?
2-[4-[4-[[[(E)-2-nitroethenyl]amino]methylamino]butyl]-1,3-thiazol-2-yl]guanidine has a molecular weight of 313.39 g/mol, XLogP of 0.26, 10 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[4-[[[(E)-2-nitroethenyl]amino]methylamino]butyl]-1,3-thiazol-2-yl]guanidine is sourced from PubChem (CID 88798232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).