C12H12Cl4N2O2S4 — CID 88798392
dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;2,3,5,6-tetrachlorocyclohexa-2,5-diene-1,4-dione (PubChem CID 88798392) has the molecular formula C12H12Cl4N2O2S4 and a molecular weight of 486.32 g/mol. Its IUPAC name is dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;2,3,5,6-tetrachlorocyclohexa-2,5-diene-1,4-dione.
| Compound Name | dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;2,3,5,6-tetrachlorocyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 88798392 |
| Molecular Formula | C12H12Cl4N2O2S4 |
| Molecular Weight | 486.32 g/mol |
| Exact Mass | 483.85 |
| IUPAC Name | dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;2,3,5,6-tetrachlorocyclohexa-2,5-diene-1,4-dione |
| SMILES | CN(C)C(=S)SSC(=S)N(C)C.O=C1C(Cl)=C(Cl)C(=O)C(Cl)=C1Cl |
| InChI | InChI=1S/C6Cl4O2.C6H12N2S4/c7-1-2(8)6(12)4(10)3(9)5(1)11;1-7(2)5(9)11-12-6(10)8(3)4/h;1-4H3 |
| InChIKey | BWQLQHSSLSWJBB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.32 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|