About 2-(2-acetamido-2-oxoethyl)sulfanyl-N-acetylacetamide;N-acetyl-2-sulfanylacetamide
2-(2-acetamido-2-oxoethyl)sulfanyl-N-acetylacetamide;N-acetyl-2-sulfanylacetamide (PubChem CID 88798727) has the molecular formula C12H19N3O6S2
and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-(2-acetamido-2-oxoethyl)sulfanyl-N-acetylacetamide;N-acetyl-2-sulfanylacetamide.
Molecular Properties
| Compound Name | 2-(2-acetamido-2-oxoethyl)sulfanyl-N-acetylacetamide;N-acetyl-2-sulfanylacetamide |
| PubChem CID | 88798727 |
| Molecular Formula | C12H19N3O6S2 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 2-(2-acetamido-2-oxoethyl)sulfanyl-N-acetylacetamide;N-acetyl-2-sulfanylacetamide |
| SMILES | CC(=O)NC(=O)CS.CC(=O)NC(=O)CSCC(=O)NC(C)=O |
| InChI | InChI=1S/C8H12N2O4S.C4H7NO2S/c1-5(11)9-7(13)3-15-4-8(14)10-6(2)12;1-3(6)5-4(7)2-8/h3-4H2,1-2H3,(H,9,11,13)(H,10,12,14);8H,2H2,1H3,(H,5,6,7) |
| InChIKey | ZVVGBGYSCSXEPK-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 138.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-acetamido-2-oxoethyl)sulfanyl-N-acetylacetamide;N-acetyl-2-sulfanylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-acetamido-2-oxoethyl)sulfanyl-N-acetylacetamide;N-acetyl-2-sulfanylacetamide?
The IUPAC name of 2-(2-acetamido-2-oxoethyl)sulfanyl-N-acetylacetamide;N-acetyl-2-sulfanylacetamide (CID 88798727) is 2-(2-acetamido-2-oxoethyl)sulfanyl-N-acetylacetamide;N-acetyl-2-sulfanylacetamide.
What is the SMILES notation for 2-(2-acetamido-2-oxoethyl)sulfanyl-N-acetylacetamide;N-acetyl-2-sulfanylacetamide?
The canonical SMILES for 2-(2-acetamido-2-oxoethyl)sulfanyl-N-acetylacetamide;N-acetyl-2-sulfanylacetamide is CC(=O)NC(=O)CS.CC(=O)NC(=O)CSCC(=O)NC(C)=O.
What is the InChIKey of 2-(2-acetamido-2-oxoethyl)sulfanyl-N-acetylacetamide;N-acetyl-2-sulfanylacetamide?
The InChIKey is ZVVGBGYSCSXEPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O4S.C4H7NO2S/c1-5(11)9-7(13)3-15-4-8(14)10-6(2)12;1-3(6)5-4(7)2-8/h3-4H2,1-2H3,(H,9,11,13)(H,10,12,14);8H,2H2,1H3,(H,5,6,7).
What are the key properties of 2-(2-acetamido-2-oxoethyl)sulfanyl-N-acetylacetamide;N-acetyl-2-sulfanylacetamide?
2-(2-acetamido-2-oxoethyl)sulfanyl-N-acetylacetamide;N-acetyl-2-sulfanylacetamide has a molecular weight of 365.43 g/mol, XLogP of -1.38, 5 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-acetamido-2-oxoethyl)sulfanyl-N-acetylacetamide;N-acetyl-2-sulfanylacetamide is sourced from PubChem (CID 88798727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).