About S-(2,5-dioxopyrrolidin-1-yl) propanethioate
S-(2,5-dioxopyrrolidin-1-yl) propanethioate (PubChem CID 88798818) has the molecular formula C7H9NO3S
and a molecular weight of 187.22 g/mol. Its IUPAC name is S-(2,5-dioxopyrrolidin-1-yl) propanethioate.
Molecular Properties
| Compound Name | S-(2,5-dioxopyrrolidin-1-yl) propanethioate |
| PubChem CID | 88798818 |
| Molecular Formula | C7H9NO3S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.03 |
| IUPAC Name | S-(2,5-dioxopyrrolidin-1-yl) propanethioate |
| SMILES | CCC(=O)SN1C(=O)CCC1=O |
| InChI | InChI=1S/C7H9NO3S/c1-2-7(11)12-8-5(9)3-4-6(8)10/h2-4H2,1H3 |
| InChIKey | IGDXXWUITHUQAT-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2,5-dioxopyrrolidin-1-yl) propanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2,5-dioxopyrrolidin-1-yl) propanethioate?
The IUPAC name of S-(2,5-dioxopyrrolidin-1-yl) propanethioate (CID 88798818) is S-(2,5-dioxopyrrolidin-1-yl) propanethioate.
What is the SMILES notation for S-(2,5-dioxopyrrolidin-1-yl) propanethioate?
The canonical SMILES for S-(2,5-dioxopyrrolidin-1-yl) propanethioate is CCC(=O)SN1C(=O)CCC1=O.
What is the InChIKey of S-(2,5-dioxopyrrolidin-1-yl) propanethioate?
The InChIKey is IGDXXWUITHUQAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3S/c1-2-7(11)12-8-5(9)3-4-6(8)10/h2-4H2,1H3.
What are the key properties of S-(2,5-dioxopyrrolidin-1-yl) propanethioate?
S-(2,5-dioxopyrrolidin-1-yl) propanethioate has a molecular weight of 187.22 g/mol, XLogP of 0.72, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2,5-dioxopyrrolidin-1-yl) propanethioate is sourced from PubChem (CID 88798818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).