About 9H-thieno[2,3-i][1]benzazepine
9H-thieno[2,3-i][1]benzazepine (PubChem CID 88798857) has the molecular formula C12H9NS
and a molecular weight of 199.28 g/mol. Its IUPAC name is 9H-thieno[2,3-i][1]benzazepine.
Molecular Properties
| Compound Name | 9H-thieno[2,3-i][1]benzazepine |
| PubChem CID | 88798857 |
| Molecular Formula | C12H9NS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 9H-thieno[2,3-i][1]benzazepine |
| SMILES | C1=CN=c2c(ccc3c2=CCS3)C=C1 |
| InChI | InChI=1S/C12H9NS/c1-2-7-13-12-9(3-1)4-5-11-10(12)6-8-14-11/h1-7H,8H2 |
| InChIKey | UORQOUXDTZZJLA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9H-thieno[2,3-i][1]benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-thieno[2,3-i][1]benzazepine?
The IUPAC name of 9H-thieno[2,3-i][1]benzazepine (CID 88798857) is 9H-thieno[2,3-i][1]benzazepine.
What is the SMILES notation for 9H-thieno[2,3-i][1]benzazepine?
The canonical SMILES for 9H-thieno[2,3-i][1]benzazepine is C1=CN=c2c(ccc3c2=CCS3)C=C1.
What is the InChIKey of 9H-thieno[2,3-i][1]benzazepine?
The InChIKey is UORQOUXDTZZJLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NS/c1-2-7-13-12-9(3-1)4-5-11-10(12)6-8-14-11/h1-7H,8H2.
What are the key properties of 9H-thieno[2,3-i][1]benzazepine?
9H-thieno[2,3-i][1]benzazepine has a molecular weight of 199.28 g/mol, XLogP of 1.73, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-thieno[2,3-i][1]benzazepine is sourced from PubChem (CID 88798857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).