C9H18ClN5 — CID 88798896
6-chloro-1,3,5-triazine-2,4-diamine;2,2-dimethylbutane (PubChem CID 88798896) has the molecular formula C9H18ClN5 and a molecular weight of 231.73 g/mol. Its IUPAC name is 6-chloro-1,3,5-triazine-2,4-diamine;2,2-dimethylbutane.
| Compound Name | 6-chloro-1,3,5-triazine-2,4-diamine;2,2-dimethylbutane |
|---|---|
| PubChem CID | 88798896 |
| Molecular Formula | C9H18ClN5 |
| Molecular Weight | 231.73 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 6-chloro-1,3,5-triazine-2,4-diamine;2,2-dimethylbutane |
| SMILES | CCC(C)(C)C.Nc1nc(N)nc(Cl)n1 |
| InChI | InChI=1S/C6H14.C3H4ClN5/c1-5-6(2,3)4;4-1-7-2(5)9-3(6)8-1/h5H2,1-4H3;(H4,5,6,7,8,9) |
| InChIKey | RNLHLHDBDOYARG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.73 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |