C9H14IN — CID 88799452
3-ethenyl-1,6-dimethyl-2H-pyridine;hydroiodide (PubChem CID 88799452) has the molecular formula C9H14IN and a molecular weight of 263.12 g/mol. Its IUPAC name is 3-ethenyl-1,6-dimethyl-2H-pyridine;hydroiodide.
| Compound Name | 3-ethenyl-1,6-dimethyl-2H-pyridine;hydroiodide |
|---|---|
| PubChem CID | 88799452 |
| Molecular Formula | C9H14IN |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 3-ethenyl-1,6-dimethyl-2H-pyridine;hydroiodide |
| SMILES | C=CC1=CC=C(C)N(C)C1.I |
| InChI | InChI=1S/C9H13N.HI/c1-4-9-6-5-8(2)10(3)7-9;/h4-6H,1,7H2,2-3H3;1H |
| InChIKey | UCZSPEGBFBPBFA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|