C23H26F3NO3 — CID 88799490
2-[[2,2-dimethyl-4-[[3-(trifluoromethyl)phenyl]methylidene]-3H-chromen-7-yl]peroxy]-N,N-dimethylethanamine (PubChem CID 88799490) has the molecular formula C23H26F3NO3 and a molecular weight of 421.46 g/mol. Its IUPAC name is 2-[[2,2-dimethyl-4-[[3-(trifluoromethyl)phenyl]methylidene]-3H-chromen-7-yl]peroxy]-N,N-dimethylethanamine.
| Compound Name | 2-[[2,2-dimethyl-4-[[3-(trifluoromethyl)phenyl]methylidene]-3H-chromen-7-yl]peroxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 88799490 |
| Molecular Formula | C23H26F3NO3 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 2-[[2,2-dimethyl-4-[[3-(trifluoromethyl)phenyl]methylidene]-3H-chromen-7-yl]peroxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCOOc1ccc2c(c1)OC(C)(C)CC2=Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H26F3NO3/c1-22(2)15-17(12-16-6-5-7-18(13-16)23(24,25)26)20-9-8-19(14-21(20)29-22)30-28-11-10-27(3)4/h5-9,12-14H,10-11,15H2,1-4H3 |
| InChIKey | FDOFKKNUHHVPNL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|