About dichloro-(5,6-dihydro-4H-1,3-thiazin-2-yl)-phenyl-λ4-sulfane
dichloro-(5,6-dihydro-4H-1,3-thiazin-2-yl)-phenyl-λ4-sulfane (PubChem CID 88799494) has the molecular formula C10H11Cl2NS2
and a molecular weight of 280.25 g/mol. Its IUPAC name is dichloro-(5,6-dihydro-4H-1,3-thiazin-2-yl)-phenyl-λ4-sulfane.
Molecular Properties
| Compound Name | dichloro-(5,6-dihydro-4H-1,3-thiazin-2-yl)-phenyl-λ4-sulfane |
| PubChem CID | 88799494 |
| Molecular Formula | C10H11Cl2NS2 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 278.97 |
| IUPAC Name | dichloro-(5,6-dihydro-4H-1,3-thiazin-2-yl)-phenyl-λ4-sulfane |
| SMILES | ClS(Cl)(C1=NCCCS1)c1ccccc1 |
| InChI | InChI=1S/C10H11Cl2NS2/c11-15(12,9-5-2-1-3-6-9)10-13-7-4-8-14-10/h1-3,5-6H,4,7-8H2 |
| InChIKey | RVCAAOYLNJFHDQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dichloro-(5,6-dihydro-4H-1,3-thiazin-2-yl)-phenyl-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro-(5,6-dihydro-4H-1,3-thiazin-2-yl)-phenyl-λ4-sulfane?
The IUPAC name of dichloro-(5,6-dihydro-4H-1,3-thiazin-2-yl)-phenyl-λ4-sulfane (CID 88799494) is dichloro-(5,6-dihydro-4H-1,3-thiazin-2-yl)-phenyl-λ4-sulfane.
What is the SMILES notation for dichloro-(5,6-dihydro-4H-1,3-thiazin-2-yl)-phenyl-λ4-sulfane?
The canonical SMILES for dichloro-(5,6-dihydro-4H-1,3-thiazin-2-yl)-phenyl-λ4-sulfane is ClS(Cl)(C1=NCCCS1)c1ccccc1.
What is the InChIKey of dichloro-(5,6-dihydro-4H-1,3-thiazin-2-yl)-phenyl-λ4-sulfane?
The InChIKey is RVCAAOYLNJFHDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Cl2NS2/c11-15(12,9-5-2-1-3-6-9)10-13-7-4-8-14-10/h1-3,5-6H,4,7-8H2.
What are the key properties of dichloro-(5,6-dihydro-4H-1,3-thiazin-2-yl)-phenyl-λ4-sulfane?
dichloro-(5,6-dihydro-4H-1,3-thiazin-2-yl)-phenyl-λ4-sulfane has a molecular weight of 280.25 g/mol, XLogP of 4.65, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro-(5,6-dihydro-4H-1,3-thiazin-2-yl)-phenyl-λ4-sulfane is sourced from PubChem (CID 88799494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).