C17H20Cl6N2O2 — CID 88799513
1,1,2-trichloroethyl N-[2-(3,4-dichloroanilino)cyclopentyl]-N-prop-2-enylcarbamate;hydrochloride (PubChem CID 88799513) has the molecular formula C17H20Cl6N2O2 and a molecular weight of 497.08 g/mol. Its IUPAC name is 1,1,2-trichloroethyl N-[2-(3,4-dichloroanilino)cyclopentyl]-N-prop-2-enylcarbamate;hydrochloride.
| Compound Name | 1,1,2-trichloroethyl N-[2-(3,4-dichloroanilino)cyclopentyl]-N-prop-2-enylcarbamate;hydrochloride |
|---|---|
| PubChem CID | 88799513 |
| Molecular Formula | C17H20Cl6N2O2 |
| Molecular Weight | 497.08 g/mol |
| Exact Mass | 493.97 |
| IUPAC Name | 1,1,2-trichloroethyl N-[2-(3,4-dichloroanilino)cyclopentyl]-N-prop-2-enylcarbamate;hydrochloride |
| SMILES | C=CCN(C(=O)OC(Cl)(Cl)CCl)C1CCCC1Nc1ccc(Cl)c(Cl)c1.Cl |
| InChI | InChI=1S/C17H19Cl5N2O2.ClH/c1-2-8-24(16(25)26-17(21,22)10-18)15-5-3-4-14(15)23-11-6-7-12(19)13(20)9-11;/h2,6-7,9,14-15,23H,1,3-5,8,10H2;1H |
| InChIKey | ZOMSMUCVELJRSQ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.08 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|