About 6-diazocyclohexa-2,4-diene-1-carboxamide
6-diazocyclohexa-2,4-diene-1-carboxamide (PubChem CID 88799553) has the molecular formula C7H7N3O
and a molecular weight of 149.15 g/mol. Its IUPAC name is 6-diazocyclohexa-2,4-diene-1-carboxamide.
Molecular Properties
| Compound Name | 6-diazocyclohexa-2,4-diene-1-carboxamide |
| PubChem CID | 88799553 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 6-diazocyclohexa-2,4-diene-1-carboxamide |
| SMILES | [N-]=[N+]=C1C=CC=CC1C(N)=O |
| InChI | InChI=1S/C7H7N3O/c8-7(11)5-3-1-2-4-6(5)10-9/h1-5H,(H2,8,11) |
| InChIKey | SVFNSSLNPZIZRE-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 6-diazocyclohexa-2,4-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-diazocyclohexa-2,4-diene-1-carboxamide?
The IUPAC name of 6-diazocyclohexa-2,4-diene-1-carboxamide (CID 88799553) is 6-diazocyclohexa-2,4-diene-1-carboxamide.
What is the SMILES notation for 6-diazocyclohexa-2,4-diene-1-carboxamide?
The canonical SMILES for 6-diazocyclohexa-2,4-diene-1-carboxamide is [N-]=[N+]=C1C=CC=CC1C(N)=O.
What is the InChIKey of 6-diazocyclohexa-2,4-diene-1-carboxamide?
The InChIKey is SVFNSSLNPZIZRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O/c8-7(11)5-3-1-2-4-6(5)10-9/h1-5H,(H2,8,11).
What are the key properties of 6-diazocyclohexa-2,4-diene-1-carboxamide?
6-diazocyclohexa-2,4-diene-1-carboxamide has a molecular weight of 149.15 g/mol, XLogP of -0.12, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-diazocyclohexa-2,4-diene-1-carboxamide is sourced from PubChem (CID 88799553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).