About 4-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)phenol
4-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)phenol (PubChem CID 88799728) has the molecular formula C13H8ClF3O2
and a molecular weight of 288.65 g/mol. Its IUPAC name is 4-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)phenol.
Molecular Properties
| Compound Name | 4-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)phenol |
| PubChem CID | 88799728 |
| Molecular Formula | C13H8ClF3O2 |
| Molecular Weight | 288.65 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 4-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)phenol |
| SMILES | Cc1c(F)c(F)c(Oc2ccc(O)cc2)c(Cl)c1F |
| InChI | InChI=1S/C13H8ClF3O2/c1-6-10(15)9(14)13(12(17)11(6)16)19-8-4-2-7(18)3-5-8/h2-5,18H,1H3 |
| InChIKey | WJJLTQKVHZZVDE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.65 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)phenol?
The IUPAC name of 4-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)phenol (CID 88799728) is 4-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)phenol.
What is the SMILES notation for 4-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)phenol?
The canonical SMILES for 4-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)phenol is Cc1c(F)c(F)c(Oc2ccc(O)cc2)c(Cl)c1F.
What is the InChIKey of 4-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)phenol?
The InChIKey is WJJLTQKVHZZVDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClF3O2/c1-6-10(15)9(14)13(12(17)11(6)16)19-8-4-2-7(18)3-5-8/h2-5,18H,1H3.
What are the key properties of 4-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)phenol?
4-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)phenol has a molecular weight of 288.65 g/mol, XLogP of 4.56, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)phenol is sourced from PubChem (CID 88799728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).