About 4-methyloct-1-yn-4-ol;triethyl(triethylsilyloxy)silane
4-methyloct-1-yn-4-ol;triethyl(triethylsilyloxy)silane (PubChem CID 88799774) has the molecular formula C21H46O2Si2
and a molecular weight of 386.77 g/mol. Its IUPAC name is 4-methyloct-1-yn-4-ol;triethyl(triethylsilyloxy)silane.
Molecular Properties
| Compound Name | 4-methyloct-1-yn-4-ol;triethyl(triethylsilyloxy)silane |
| PubChem CID | 88799774 |
| Molecular Formula | C21H46O2Si2 |
| Molecular Weight | 386.77 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | 4-methyloct-1-yn-4-ol;triethyl(triethylsilyloxy)silane |
| SMILES | C#CCC(C)(O)CCCC.CC[Si](CC)(CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C12H30OSi2.C9H16O/c1-7-14(8-2,9-3)13-15(10-4,11-5)12-6;1-4-6-8-9(3,10)7-5-2/h7-12H2,1-6H3;2,10H,4,6-8H2,1,3H3 |
| InChIKey | WXWMXFSLCGAGJW-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.77 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methyloct-1-yn-4-ol;triethyl(triethylsilyloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyloct-1-yn-4-ol;triethyl(triethylsilyloxy)silane?
The IUPAC name of 4-methyloct-1-yn-4-ol;triethyl(triethylsilyloxy)silane (CID 88799774) is 4-methyloct-1-yn-4-ol;triethyl(triethylsilyloxy)silane.
What is the SMILES notation for 4-methyloct-1-yn-4-ol;triethyl(triethylsilyloxy)silane?
The canonical SMILES for 4-methyloct-1-yn-4-ol;triethyl(triethylsilyloxy)silane is C#CCC(C)(O)CCCC.CC[Si](CC)(CC)O[Si](CC)(CC)CC.
What is the InChIKey of 4-methyloct-1-yn-4-ol;triethyl(triethylsilyloxy)silane?
The InChIKey is WXWMXFSLCGAGJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H30OSi2.C9H16O/c1-7-14(8-2,9-3)13-15(10-4,11-5)12-6;1-4-6-8-9(3,10)7-5-2/h7-12H2,1-6H3;2,10H,4,6-8H2,1,3H3.
What are the key properties of 4-methyloct-1-yn-4-ol;triethyl(triethylsilyloxy)silane?
4-methyloct-1-yn-4-ol;triethyl(triethylsilyloxy)silane has a molecular weight of 386.77 g/mol, XLogP of 6.96, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyloct-1-yn-4-ol;triethyl(triethylsilyloxy)silane is sourced from PubChem (CID 88799774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).