C19H18N6O4S3 — CID 88799809
(6S)-7-[(2-hydrazinylidene-2-phenylacetyl)amino]-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88799809) has the molecular formula C19H18N6O4S3 and a molecular weight of 490.59 g/mol. Its IUPAC name is (6S)-7-[(2-hydrazinylidene-2-phenylacetyl)amino]-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-7-[(2-hydrazinylidene-2-phenylacetyl)amino]-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88799809 |
| Molecular Formula | C19H18N6O4S3 |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | (6S)-7-[(2-hydrazinylidene-2-phenylacetyl)amino]-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | Cc1nnc(SCC2=C(C(=O)O)N3C(=O)C(NC(=O)C(=NN)c4ccccc4)[C@@H]3SC2)s1 |
| InChI | InChI=1S/C19H18N6O4S3/c1-9-23-24-19(32-9)31-8-11-7-30-17-13(16(27)25(17)14(11)18(28)29)21-15(26)12(22-20)10-5-3-2-4-6-10/h2-6,13,17H,7-8,20H2,1H3,(H,21,26)(H,28,29)/t13?,17-/m0/s1 |
| InChIKey | ISBGIGVTVQUHOQ-RUINGEJQSA-N |
| XLogP | 1.04 |
| TPSA | 150.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|