About propanoyl 4-hydroxybutanoate
propanoyl 4-hydroxybutanoate (PubChem CID 88799917) has the molecular formula C7H12O4
and a molecular weight of 160.17 g/mol. Its IUPAC name is propanoyl 4-hydroxybutanoate.
Molecular Properties
| Compound Name | propanoyl 4-hydroxybutanoate |
| PubChem CID | 88799917 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | propanoyl 4-hydroxybutanoate |
| SMILES | CCC(=O)OC(=O)CCCO |
| InChI | InChI=1S/C7H12O4/c1-2-6(9)11-7(10)4-3-5-8/h8H,2-5H2,1H3 |
| InChIKey | RHMFJZPVWPIXBJ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze propanoyl 4-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanoyl 4-hydroxybutanoate?
The IUPAC name of propanoyl 4-hydroxybutanoate (CID 88799917) is propanoyl 4-hydroxybutanoate.
What is the SMILES notation for propanoyl 4-hydroxybutanoate?
The canonical SMILES for propanoyl 4-hydroxybutanoate is CCC(=O)OC(=O)CCCO.
What is the InChIKey of propanoyl 4-hydroxybutanoate?
The InChIKey is RHMFJZPVWPIXBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4/c1-2-6(9)11-7(10)4-3-5-8/h8H,2-5H2,1H3.
What are the key properties of propanoyl 4-hydroxybutanoate?
propanoyl 4-hydroxybutanoate has a molecular weight of 160.17 g/mol, XLogP of 0.24, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propanoyl 4-hydroxybutanoate is sourced from PubChem (CID 88799917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).