About 3-bromo-4,5-bis(prop-2-enyl)-1,3-oxazol-2-one
3-bromo-4,5-bis(prop-2-enyl)-1,3-oxazol-2-one (PubChem CID 88800322) has the molecular formula C9H10BrNO2
and a molecular weight of 244.09 g/mol. Its IUPAC name is 3-bromo-4,5-bis(prop-2-enyl)-1,3-oxazol-2-one.
Molecular Properties
| Compound Name | 3-bromo-4,5-bis(prop-2-enyl)-1,3-oxazol-2-one |
| PubChem CID | 88800322 |
| Molecular Formula | C9H10BrNO2 |
| Molecular Weight | 244.09 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | 3-bromo-4,5-bis(prop-2-enyl)-1,3-oxazol-2-one |
| SMILES | C=CCc1oc(=O)n(Br)c1CC=C |
| InChI | InChI=1S/C9H10BrNO2/c1-3-5-7-8(6-4-2)13-9(12)11(7)10/h3-4H,1-2,5-6H2 |
| InChIKey | MVFLYEWADDMRAW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.09 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-4,5-bis(prop-2-enyl)-1,3-oxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4,5-bis(prop-2-enyl)-1,3-oxazol-2-one?
The IUPAC name of 3-bromo-4,5-bis(prop-2-enyl)-1,3-oxazol-2-one (CID 88800322) is 3-bromo-4,5-bis(prop-2-enyl)-1,3-oxazol-2-one.
What is the SMILES notation for 3-bromo-4,5-bis(prop-2-enyl)-1,3-oxazol-2-one?
The canonical SMILES for 3-bromo-4,5-bis(prop-2-enyl)-1,3-oxazol-2-one is C=CCc1oc(=O)n(Br)c1CC=C.
What is the InChIKey of 3-bromo-4,5-bis(prop-2-enyl)-1,3-oxazol-2-one?
The InChIKey is MVFLYEWADDMRAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrNO2/c1-3-5-7-8(6-4-2)13-9(12)11(7)10/h3-4H,1-2,5-6H2.
What are the key properties of 3-bromo-4,5-bis(prop-2-enyl)-1,3-oxazol-2-one?
3-bromo-4,5-bis(prop-2-enyl)-1,3-oxazol-2-one has a molecular weight of 244.09 g/mol, XLogP of 2.06, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4,5-bis(prop-2-enyl)-1,3-oxazol-2-one is sourced from PubChem (CID 88800322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).