C20H30O3 — CID 88800806
(1S,5S,10S,11S,14S,15S)-5-hydroxy-14-(1-hydroxyethyl)-15-methyltricyclo[8.7.0.011,15]heptadec-7-yn-2-one (PubChem CID 88800806) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1S,5S,10S,11S,14S,15S)-5-hydroxy-14-(1-hydroxyethyl)-15-methyltricyclo[8.7.0.011,15]heptadec-7-yn-2-one.
| Compound Name | (1S,5S,10S,11S,14S,15S)-5-hydroxy-14-(1-hydroxyethyl)-15-methyltricyclo[8.7.0.011,15]heptadec-7-yn-2-one |
|---|---|
| PubChem CID | 88800806 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1S,5S,10S,11S,14S,15S)-5-hydroxy-14-(1-hydroxyethyl)-15-methyltricyclo[8.7.0.011,15]heptadec-7-yn-2-one |
| SMILES | CC(O)[C@H]1CC[C@H]2[C@@H]3CC#CC[C@@H](O)CCC(=O)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C20H30O3/c1-13(21)17-8-9-18-15-6-4-3-5-14(22)7-10-19(23)16(15)11-12-20(17,18)2/h13-18,21-22H,5-12H2,1-2H3/t13?,14-,15-,16+,17-,18+,20-/m1/s1 |
| InChIKey | FYVDRICZTFFKGT-BMZGQPSPSA-N |
| XLogP | 2.93 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|