C21H28O3 — CID 88801345
(8R,9S,10R,13S,14S)-1,1,13-trimethyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-10-carbaldehyde (PubChem CID 88801345) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-1,1,13-trimethyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-10-carbaldehyde.
| Compound Name | (8R,9S,10R,13S,14S)-1,1,13-trimethyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-10-carbaldehyde |
|---|---|
| PubChem CID | 88801345 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (8R,9S,10R,13S,14S)-1,1,13-trimethyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-10-carbaldehyde |
| SMILES | CC1(C)CC(=O)C=C2CC[C@@H]3[C@H](CC[C@]4(C)C(=O)CC[C@@H]34)[C@]21C=O |
| InChI | InChI=1S/C21H28O3/c1-19(2)11-14(23)10-13-4-5-15-16-6-7-18(24)20(16,3)9-8-17(15)21(13,19)12-22/h10,12,15-17H,4-9,11H2,1-3H3/t15-,16-,17-,20-,21-/m0/s1 |
| InChIKey | CGMLRUNEDFADPZ-RNEDXHKXSA-N |
| XLogP | 3.90 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|